CAS 93942-41-7

Phenylmethyl carbonofluoridate

Description:

Phenylmethyl carbonofluoridate, also known by its CAS number 93942-41-7, is an organofluorine compound characterized by the presence of both phenyl and methyl groups attached to a carbonyl moiety that is further substituted with fluorine. This compound typically exhibits a colorless to pale yellow liquid form and is known for its reactivity, particularly in nucleophilic substitution reactions due to the electrophilic nature of the carbonyl carbon. Its structure allows for potential applications in organic synthesis and as an intermediate in the production of various fluorinated compounds. The presence of fluorine atoms imparts unique properties, such as increased lipophilicity and stability against hydrolysis compared to non-fluorinated analogs. However, due to its potential toxicity and environmental impact, handling requires appropriate safety measures. As with many organofluorine compounds, it is essential to consider its behavior in biological systems and the environment, as well as its regulatory status in various jurisdictions.

Formula: C₈H₇FO₂

InChI: InChI=1S/C8H7FO2/c9-8(10)11-6-7-4-2-1-3-5-7/h1-5H,6H2

InChI key: InChIKey=ZDRODIGYILKBLQ-UHFFFAOYSA-N

SMILES: C(OC(F)=O)C1=CC=CC=C1

Synonyms:

• Benzyl Fluorocarbonate
• Carbonofluoridic acid, phenylmethyl ester
• Phenylmethyl carbonofluoridate
• Benzyl fluoroformate