
CAS 93951-17-8
:28,28-Dibutyl-3,6,9,12,15,18,21,24,27-nonaoxa-28-stannadotriacontan-1-ol
Description:
28,28-Dibutyl-3,6,9,12,15,18,21,24,27-nonaoxa-28-stannadotriacontan-1-ol, with CAS number 93951-17-8, is a complex organotin compound characterized by its long carbon chain and multiple ether linkages. This substance features a stannane (tin-containing) core, which contributes to its unique chemical properties, including potential applications in materials science and as a stabilizer in various formulations. The presence of multiple butyl groups enhances its hydrophobic characteristics, while the long polyether chain may impart flexibility and solubility in organic solvents. Additionally, the hydroxyl group (-OH) at one end of the molecule can participate in hydrogen bonding, influencing its reactivity and interactions with other substances. Such compounds are often studied for their potential uses in catalysis, as additives in plastics, or in biocidal applications, although their environmental impact and toxicity must be carefully evaluated due to the presence of tin. Overall, this compound exemplifies the intricate balance between functionality and safety in organotin chemistry.
Formula:C30H64O10Sn
InChI:InChI=1S/C18H37O10.3C4H9.Sn/c19-1-3-21-5-7-23-9-11-25-13-15-27-17-18-28-16-14-26-12-10-24-8-6-22-4-2-20;3*1-3-4-2;/h19H,1-18H2;3*1,3-4H2,2H3;/q-1;;;;+1
InChI key:InChIKey=KKZNWKXBSPLDMB-UHFFFAOYSA-N
SMILES:[Sn](OCCOCCOCCOCCOCCOCCOCCOCCOCCO)(CCCC)(CCCC)CCCC
Synonyms:- 3,6,9,12,15,18,21,24,27-Nonaoxa-28-stannadotriacontan-1-ol, 28,28-dibutyl-
- 28,28-Dibutyl-3,6,9,12,15,18,21,24,27-nonaoxa-28-stannadotriacontan-1-ol
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
28,28-DIBUTYL-3,6,9,12,15,18,21,24,27-NONAOXA-28-STANNADOTRIACONTAN-1-OL
CAS:Formula:C30H64O10SnMolecular weight:703.5242
