CAS 93951-90-7

Benzene, 2-(methyl-d3)-1,3-dinitro-

Description:

Benzene, 2-(methyl-d3)-1,3-dinitro- is a substituted aromatic compound characterized by the presence of a benzene ring with two nitro groups and a deuterated methyl group. The deuterated methyl group indicates that the hydrogen atoms in the methyl group are replaced with deuterium, a stable isotope of hydrogen, which can be useful in various analytical and research applications. This compound is typically used in chemical synthesis and may serve as an intermediate in the production of other chemicals. The presence of nitro groups contributes to its reactivity, making it a potential candidate for further chemical transformations. Additionally, the compound's physical properties, such as solubility and boiling point, are influenced by the nitro groups and the aromatic structure. Safety considerations are important when handling this compound, as nitro-substituted aromatic compounds can be hazardous and may pose environmental risks. Proper storage and handling protocols should be followed to mitigate any potential risks associated with its use.

Formula: C₇H₃D₃N₂O₄

InChI: InChI=1S/C7H6N2O4/c1-5-6(8(10)11)3-2-4-7(5)9(12)13/h2-4H,1H3/i1D3

InChI key: InChIKey=XTRDKALNCIHHNI-FIBGUPNXSA-N

SMILES: N(=O)(=O)C1=C(C([2H])([2H])[2H])C(N(=O)=O)=CC=C1

Synonyms:

• Benzene, 2-(methyl-d3)-1,3-dinitro-

2,6-Dinitrotoluene-α,α,α-d3

CAS: 93951-90-7

Formula: (NO₂)₂C₆H₃CD₃

Purity: 98 atom % D

Color and Shape: White-Pale Yellow Solid

Molecular weight: 185.05159

Ref: 3U-D2359

2,6-Dinitrotoluene-α,α,α-d3

Controlled Product

CAS: 93951-90-7

Applications 2,6-Dinitrotoluene-alpha,alpha,alpha-d3 (CAS# 93951-90-7) is a useful isotopically labeled research compound.

Formula: C₇H₃D₃N₂O₄

Color and Shape: Neat

Molecular weight: 185.15

Ref: TR-D480426