CAS 93957-51-8
:1-(4-fluorophenyl)-2-[(1-methylethyl)(phenyl)amino]ethanone
Description:
1-(4-Fluorophenyl)-2-[(1-methylethyl)(phenyl)amino]ethanone, with CAS number 93957-51-8, is an organic compound characterized by its complex structure, which includes a ketone functional group and an amine moiety. The presence of a fluorine atom on the phenyl ring enhances its electronic properties, potentially influencing its reactivity and interactions in biological systems. This compound features a branched isopropyl group attached to the nitrogen atom, which may contribute to steric hindrance and affect its binding affinity in pharmacological contexts. The ketone group is indicative of potential reactivity in nucleophilic addition reactions. Overall, this compound may exhibit interesting biological activities, making it a subject of interest in medicinal chemistry and drug development. Its specific properties, such as solubility, melting point, and stability, would depend on the molecular interactions and the environment in which it is studied. Further research would be necessary to fully elucidate its characteristics and potential applications.
Formula:C17H18FNO
InChI:InChI=1/C17H18FNO/c1-13(2)19(16-6-4-3-5-7-16)12-17(20)14-8-10-15(18)11-9-14/h3-11,13H,12H2,1-2H3
SMILES:CC(C)N(CC(=O)c1ccc(cc1)F)c1ccccc1
Synonyms:- 1-(4-Fluorophenyl)-2-[isopropyl(phenyl)amino]ethanone
- ethanone, 1-(4-fluorophenyl)-2-[(1-methylethyl)phenylamino]-1-(4-Fluoro-Phenyl)-2-(Isopropyl-Phenyl-Amino)-Ethanone
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.