CAS 93957-52-9
:FHH
Description:
The chemical substance with the name "FHH" and CAS number 93957-52-9 is known as a synthetic compound that has garnered interest in various fields, particularly in medicinal chemistry and materials science. While specific characteristics such as its molecular structure, physical state, and reactivity may vary, compounds like FHH typically exhibit unique properties that can include specific solubility in organic solvents, stability under certain conditions, and potential biological activity. The compound may also have applications in research or industry, depending on its functional groups and overall molecular design. It is essential to consult specialized databases or scientific literature for detailed information regarding its synthesis, safety data, and potential uses, as well as to understand any regulatory considerations associated with its handling and application. Always ensure to follow appropriate safety protocols when working with chemical substances.
Formula:C25H26FNO4
InChI:InChI=1/C25H26FNO4/c1-16(2)27-22-7-5-4-6-21(22)25(17-8-10-18(26)11-9-17)23(27)13-12-19(28)14-20(29)15-24(30)31-3/h4-13,16,19,28H,14-15H2,1-3H3/b13-12+
Synonyms:- Methyl-(±)-(E)-7-[3’-(4’-fluoro-phenyl)-1’-(1’-methylethyl)indol-2’-yl]-5- hydroxy-3-oxohept-6-enoate
- methyl (E)-7-[3-(4-fluorophenyl)-1-isopropyl-indol-2-yl]-5-hydroxy-3-oxo-hept-6-enoate
- 3-Methyl(E)-7-[3-(4-Fluorophenyl)-1-Methylethyl-Indol-2-Yl]-3-Hydroxy-5-Oxohept-6-Enoate
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
(E)-Methyl 7-(3-(4-Fluorophenyl)-1-Isopropyl-1H-Indol-2-Yl)-3-Hydroxy-5-Oxohept-6-Enoate
CAS:Formula:C25H26FNO4Molecular weight:423.4766
