CAS 93958-35-1

[4-(4-methylbenzoyl)phenyl] acetate

Description:

[4-(4-methylbenzoyl)phenyl] acetate, with the CAS number 93958-35-1, is an organic compound characterized by its aromatic structure and functional groups. It features a phenyl ring substituted with a 4-methylbenzoyl group and an acetate moiety, which contributes to its reactivity and solubility properties. This compound is typically a solid at room temperature and may exhibit a crystalline or powdery form. It is likely to be soluble in organic solvents such as ethanol and acetone, while being less soluble in water due to its hydrophobic aromatic components. The presence of the acetyl group suggests potential applications in organic synthesis and as an intermediate in the production of various chemical compounds. Additionally, the compound may exhibit interesting photochemical properties, making it relevant in fields such as materials science and photochemistry. Safety data should be consulted for handling and storage, as with any chemical substance, to ensure proper precautions are taken.

Formula: C₁₆H₁₄O₃

InChI: InChI=1/C16H14O3/c1-11-3-5-13(6-4-11)16(18)14-7-9-15(10-8-14)19-12(2)17/h3-10H,1-2H3

SMILES: Cc1ccc(cc1)C(=O)c1ccc(cc1)OC(=O)C