CAS 93962-64-2
:2-Propenoic acid, 3-[6-[1-hydroxy-1-(4-methylphenyl)-3-(1-pyrrolidinyl)propyl]-2-pyridinyl]-, (E)-
Description:
2-Propenoic acid, 3-[6-[1-hydroxy-1-(4-methylphenyl)-3-(1-pyrrolidinyl)propyl]-2-pyridinyl]-, (E)-, also known by its CAS number 93962-64-2, is a chemical compound characterized by its complex structure that includes a propenoic acid moiety and a pyridine ring. This compound features a double bond characteristic of alkenes, which contributes to its reactivity, particularly in polymerization reactions. The presence of a hydroxyl group indicates potential for hydrogen bonding, enhancing its solubility in polar solvents. The pyridine and phenyl groups suggest aromatic characteristics, which can influence its electronic properties and stability. Additionally, the pyrrolidine moiety introduces a cyclic amine structure, which may affect the compound's biological activity and interactions. Overall, this compound's unique combination of functional groups makes it of interest in various fields, including medicinal chemistry and materials science, where it may serve as a building block for more complex molecules or as a potential therapeutic agent.
Formula:C22H26N2O3
InChI:InChI=1/C22H26N2O3/c1-17-7-9-18(10-8-17)22(27,13-16-24-14-2-3-15-24)20-6-4-5-19(23-20)11-12-21(25)26/h4-12,27H,2-3,13-16H2,1H3,(H,25,26)/b12-11+
InChI key:InChIKey=KBOVTNPKTWUFRD-VAWYXSNFNA-N
SMILES:C(CCN1CCCC1)(O)(C=2N=C(/C=C/C(O)=O)C=CC2)C3=CC=C(C)C=C3
Synonyms:- (2E)-3-{6-[1-hydroxy-1-(4-methylphenyl)-2-pyrrolidin-3-ylpropyl]pyridin-2-yl}prop-2-enoic acid
- 2-Propenoic acid, 3-[6-[1-hydroxy-1-(4-methylphenyl)-3-(1-pyrrolidinyl)propyl]-2-pyridinyl]-, (E)-
- (E)-3-(6-(1-Hydroxy-3-pyrrolidinyl-1-(p-tolyl)propyl)-2-pyridyl)acrylic acid
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.
(E)-3-(6-(1-(4-Tolyl)-1-hydroxy 3-pyrrolidino-propyl)-2-pyridyl)acrylic Acid
CAS:Controlled ProductFormula:C22H26N2O3Color and Shape:NeatMolecular weight:366.453

