
CAS 93962-66-4
:1-(3-Bromopropyl)-2,4-dichlorobenzene
Description:
1-(3-Bromopropyl)-2,4-dichlorobenzene is an organic compound characterized by its structure, which includes a benzene ring substituted with two chlorine atoms and a bromopropyl group. The presence of the bromine and chlorine atoms contributes to its reactivity and potential applications in various chemical reactions. This compound typically appears as a colorless to pale yellow liquid or solid, depending on the temperature and purity. It is relatively hydrophobic due to the aromatic nature of the benzene ring and the alkyl chain, which influences its solubility in organic solvents rather than water. The compound may exhibit biological activity, making it of interest in fields such as medicinal chemistry or agrochemicals. Safety considerations are important, as halogenated compounds can pose environmental and health risks, necessitating proper handling and disposal. Overall, 1-(3-Bromopropyl)-2,4-dichlorobenzene serves as a useful intermediate in organic synthesis and may have applications in material science and pharmaceuticals.
Formula:C9H9BrCl2
InChI:InChI=1S/C9H9BrCl2/c10-5-1-2-7-3-4-8(11)6-9(7)12/h3-4,6H,1-2,5H2
InChI key:InChIKey=CSYYXSGFVDABMR-UHFFFAOYSA-N
SMILES:C(CCBr)C1=C(Cl)C=C(Cl)C=C1
Synonyms:- Benzene, 1-(3-bromopropyl)-2,4-dichloro-
- 1-(3-Bromopropyl)-2,4-dichlorobenzene
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.