CAS 93963-31-6

2-Phenylbicyclo[2.2.1]heptane-2-carboxylic acid

Description:

2-Phenylbicyclo[2.2.1]heptane-2-carboxylic acid is an organic compound characterized by its bicyclic structure, which consists of a bicyclo[2.2.1] framework fused with a phenyl group and a carboxylic acid functional group. This compound features a rigid bicyclic system that contributes to its unique chemical properties, including potential steric hindrance and specific reactivity patterns. The presence of the carboxylic acid group imparts acidic characteristics, allowing it to participate in various chemical reactions, such as esterification and amidation. Additionally, the phenyl substituent can influence the compound's solubility and interaction with other molecules, making it of interest in fields such as medicinal chemistry and materials science. The compound's structural complexity may also lead to interesting stereochemical considerations. Overall, 2-Phenylbicyclo[2.2.1]heptane-2-carboxylic acid is a notable example of a bicyclic compound with potential applications in synthetic organic chemistry and drug development.

Formula: C₁₄H₁₆O₂

InChI: InChI=1S/C14H16O2/c15-13(16)14(11-4-2-1-3-5-11)9-10-6-7-12(14)8-10/h1-5,10,12H,6-9H2,(H,15,16)

InChI key: InChIKey=FODOCVXEWGKNJA-UHFFFAOYSA-N

SMILES: C(O)(=O)C1(C2CC(C1)CC2)C3=CC=CC=C3

Synonyms:

• 2-Norbornanecarboxylic acid, 2-phenyl-
• 2-Phenylnorbornane-2-Carboxylic Acid
• Bicyclo[2.2.1]heptane-2-carboxylic acid, 2-phenyl-
• 2-Phenylbicyclo[2.2.1]heptane-2-carboxylic acid
• 2-Phenylbicyclo(2.2.1)heptane-2-carboxylic acid

Bornaprine Impurity 1

CAS: 93963-31-6

Formula: C₁₄H₁₆O₂

Molecular weight: 216.28

Ref: 4Z-B-106003

2-Phenylbicyclo[2.2.1]heptane-2-carboxylic Acid

Controlled Product

CAS: 93963-31-6

Formula: C₁₄H₁₆O₂

Color and Shape: Neat

Molecular weight: 216.28

Ref: TR-P297855