CAS 93964-76-2
:N2-Formyl-L-arginine
Description:
N2-Formyl-L-arginine is a derivative of the amino acid L-arginine, characterized by the presence of a formyl group (-CHO) attached to the nitrogen atom at the second position of the side chain. This modification can influence the molecule's reactivity and biological activity. The compound is typically classified as a peptide or amino acid derivative and may play a role in various biochemical processes, including protein synthesis and metabolic pathways. Its structure allows for potential interactions with enzymes and receptors, making it of interest in pharmacological research. The CAS number 93964-76-2 uniquely identifies this compound in chemical databases, facilitating its study and application in scientific research. As with many amino acid derivatives, N2-Formyl-L-arginine may exhibit specific solubility properties, stability under various conditions, and potential for modification, which can be crucial for its use in laboratory settings or therapeutic applications. Further studies are often required to fully elucidate its biological functions and potential uses in medicine or biochemistry.
Formula:C7H14N4O3
InChI:InChI=1/C7H14N4O3/c8-7(9)10-3-1-2-5(6(13)14)11-4-12/h4-5H,1-3H2,(H,11,12)(H,13,14)(H4,8,9,10)/t5-/m0/s1
InChI key:InChIKey=MBDCBOQSTZRKJP-YFKPBYRVSA-N
SMILES:[C@@H](CCCNC(=N)N)(NC=O)C(O)=O
Synonyms:- N2-Formyl-L-arginine
- N2-formyl-L-arginine
- L-Arginine, N2-formyl-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
