CAS 93964-77-3
:L-Arginine, (2S)-2-hydroxybutanedioate (1:1)
Description:
L-Arginine, (2S)-2-hydroxybutanedioate (1:1), with the CAS number 93964-77-3, is a compound that combines the amino acid L-arginine with a salt form of 2-hydroxybutanedioic acid, commonly known as L-tartaric acid. This substance is characterized by its role in various biochemical processes, particularly in the synthesis of proteins and the production of nitric oxide, which is crucial for vascular health. L-Arginine is known for its potential benefits in enhancing blood flow and supporting cardiovascular function. The presence of the tartaric acid component may influence the solubility and stability of the compound, making it suitable for various applications in pharmaceuticals and dietary supplements. Additionally, L-arginine is recognized for its involvement in metabolic pathways, including the urea cycle, and its potential role in immune function and hormone regulation. Overall, this compound is of interest in both nutritional and therapeutic contexts, reflecting its multifaceted biological significance.
Formula:C10H20N4O7
InChI:InChI=1S/C6H14N4O2.C4H6O5/c7-4(5(11)12)2-1-3-10-6(8)9;5-2(4(8)9)1-3(6)7/h4H,1-3,7H2,(H,11,12)(H4,8,9,10);2,5H,1H2,(H,6,7)(H,8,9)/t4-;2-/m00/s1
InChI key:InChIKey=RUFJTBOKWJYXPM-ZBRNBAAYSA-N
SMILES:[C@H](CC(O)=O)(C(O)=O)O.C(CCNC(=N)N)[C@@H](C(O)=O)N
Synonyms:- <span class="text-smallcaps">L</span>-Arginine, (2S)-2-hydroxybutanedioate (1:1)
- <span class="text-smallcaps">L</span>-Arginine, (2S)-hydroxybutanedioate (1:1)
- Butanedioic acid, hydroxy-, (S)-, compd. with <span class="text-smallcaps">L</span>-arginine (1:1)
- L-Arginine L-Malate(1:1)
- L-Arginine, (2S)-hydroxybutanedioate (1:1)
- Butanedioic acid, hydroxy-, (S)-, compd. with L-arginine (1:1)
- L-Arginine, (2S)-2-hydroxybutanedioate (1:1)
- L-arginine L-malate USP/EP/BP
- L-arginine L-malate
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.