CAS 93967-77-2

1,2-Pyrrolidinedicarboxylic acid, 4-(methylthio)-, 1-(1,1-dimethylethyl) 2-methyl ester, (2S-cis)-

Description:

1,2-Pyrrolidinedicarboxylic acid, 4-(methylthio)-, 1-(1,1-dimethylethyl) 2-methyl ester, with the CAS number 93967-77-2, is a chemical compound characterized by its pyrrolidine ring structure, which is a five-membered cyclic amine. This compound features two carboxylic acid groups, indicating its potential as a dicarboxylic acid derivative, and includes a methylthio group, which can influence its reactivity and solubility. The presence of a tert-butyl group (1-(1,1-dimethylethyl)) and a methyl ester suggests that it may exhibit hydrophobic properties, making it less soluble in water but potentially soluble in organic solvents. The stereochemistry indicated by (2S-cis) suggests specific spatial arrangements of the substituents around the pyrrolidine ring, which can affect the compound's biological activity and interactions. Overall, this compound may have applications in organic synthesis, pharmaceuticals, or as a biochemical probe, although specific applications would depend on further research into its properties and behavior in various environments.

Formula: C₁₂H₂₁NO₄S

InChI: InChI=1S/C12H21NO4S/c1-12(2,3)17-11(15)13-7-8(18-5)6-9(13)10(14)16-4/h8-9H,6-7H2,1-5H3/t8-,9-/m0/s1

InChI key: InChIKey=MFVUJNIHBFNERQ-IUCAKERBSA-N

SMILES: C(OC(C)(C)C)(=O)N1[C@H](C(OC)=O)C[C@H](SC)C1

Synonyms:

• 1,2-Pyrrolidinedicarboxylic acid, 4-(methylthio)-, 1-(1,1-dimethylethyl) 2-methyl ester, (2S-cis)-