CymitQuimica logo

CAS 93974-08-4

:

2-fluorophenyl 2-nitrophenyl ether

Description:
2-Fluorophenyl 2-nitrophenyl ether, identified by its CAS number 93974-08-4, is an organic compound characterized by the presence of both a fluorine atom and a nitro group attached to phenyl rings. This compound features an ether functional group, which is formed by the linkage of two aromatic rings through an oxygen atom. The presence of the fluorine atom typically enhances the compound's reactivity and can influence its physical properties, such as solubility and boiling point. The nitro group is known for its electron-withdrawing properties, which can affect the compound's reactivity in electrophilic aromatic substitution reactions. In terms of applications, compounds like 2-fluorophenyl 2-nitrophenyl ether may be utilized in various fields, including pharmaceuticals and materials science, due to their potential as intermediates in chemical synthesis. Safety data should be consulted for handling and storage, as nitro compounds can be sensitive and may pose health risks. Overall, this compound exemplifies the complexity and utility of substituted aromatic ethers in organic chemistry.
Formula:C12H8FNO3
InChI:InChI=1/C12H8FNO3/c13-9-5-1-3-7-11(9)17-12-8-4-2-6-10(12)14(15)16/h1-8H
InChI key:XVZDYNSMGNIZSS-UHFFFAOYSA-N
SMILES:c1ccc(c(c1)F)Oc1ccccc1N(=O)=O
Synonyms:
  • 2-Fluoro-2-Nitrodiphenyl Ether
  • 1-Fluoro-2-(2-Nitrophenoxy)Benzene
Found 3 products.