
CAS 939756-04-4
:1-[(3,4-Dichlorophenyl)methyl]-1H-indazol-5-amine
Description:
1-[(3,4-Dichlorophenyl)methyl]-1H-indazol-5-amine, identified by its CAS number 939756-04-4, is a chemical compound that belongs to the indazole class of compounds. It features a distinctive structure characterized by an indazole ring fused with a phenyl group that is substituted with two chlorine atoms at the 3 and 4 positions. This substitution pattern contributes to its potential biological activity, making it of interest in medicinal chemistry. The compound is typically a solid at room temperature and may exhibit moderate solubility in organic solvents. Its properties, such as melting point, boiling point, and specific reactivity, can vary based on the purity and specific formulation. The presence of the amine functional group suggests potential for hydrogen bonding, influencing its interactions in biological systems. Research into this compound may focus on its pharmacological effects, particularly in the context of targeted therapies or as a lead compound in drug development. As with all chemical substances, proper handling and safety measures should be observed due to potential toxicity or reactivity.
Formula:C14H11Cl2N3
InChI:InChI=1S/C14H11Cl2N3/c15-12-3-1-9(5-13(12)16)8-19-14-4-2-11(17)6-10(14)7-18-19/h1-7H,8,17H2
InChI key:InChIKey=KWJBECXDDYOCBA-UHFFFAOYSA-N
SMILES:C(N1C=2C(C=N1)=CC(N)=CC2)C3=CC(Cl)=C(Cl)C=C3
Synonyms:- 1-[(3,4-Dichlorophenyl)methyl]-1H-indazol-5-amine
- 1H-Indazol-5-amine, 1-[(3,4-dichlorophenyl)methyl]-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.