CymitQuimica logo

CAS 939756-05-5

:

1-[(4-Methoxyphenyl)methyl]-1H-indazol-5-amine

Description:
1-[(4-Methoxyphenyl)methyl]-1H-indazol-5-amine is a chemical compound characterized by its indazole core, which is a five-membered heterocyclic structure containing two nitrogen atoms. The presence of a 4-methoxyphenyl group attached to the indazole framework contributes to its unique properties, including potential biological activity. This compound may exhibit various pharmacological effects, making it of interest in medicinal chemistry and drug development. Its amine functional group can participate in hydrogen bonding, influencing its solubility and reactivity. The molecular structure suggests potential interactions with biological targets, which could be explored in therapeutic contexts. Additionally, the compound's stability, solubility, and reactivity can be influenced by the methoxy group, which may affect its electronic properties. Overall, 1-[(4-Methoxyphenyl)methyl]-1H-indazol-5-amine represents a class of compounds that could be valuable in research and pharmaceutical applications, although specific biological activities and mechanisms would require further investigation.
Formula:C15H15N3O
InChI:InChI=1S/C15H15N3O/c1-19-14-5-2-11(3-6-14)10-18-15-7-4-13(16)8-12(15)9-17-18/h2-9H,10,16H2,1H3
InChI key:InChIKey=SHKCFCOEKWBMSD-UHFFFAOYSA-N
SMILES:C(N1C=2C(C=N1)=CC(N)=CC2)C3=CC=C(OC)C=C3
Synonyms:
  • 1-[(4-Methoxyphenyl)methyl]indazol-5-amine
  • 1-(4-Methoxybenzyl)-1H-indazol-5-amine
  • 1-[(4-Methoxyphenyl)methyl]-1H-indazol-5-amine
  • 1H-Indazol-5-amine, 1-[(4-methoxyphenyl)methyl]-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.