CAS 939757-41-2

1-Cyclopropyl-3-piperidinecarboxylic acid

Description:

1-Cyclopropyl-3-piperidinecarboxylic acid is a chemical compound characterized by its unique bicyclic structure, which includes a cyclopropyl group and a piperidine ring. This compound features a carboxylic acid functional group, which contributes to its acidic properties and potential reactivity. The presence of the cyclopropyl moiety can influence the compound's steric and electronic properties, potentially affecting its biological activity and interactions with other molecules. Typically, compounds like this may exhibit interesting pharmacological profiles, making them of interest in medicinal chemistry. The molecular structure allows for various potential applications, including in drug development, where modifications can lead to enhanced efficacy or selectivity. Additionally, the compound's solubility, stability, and reactivity can be influenced by the piperidine ring and the carboxylic acid group, which are important considerations in both synthetic and biological contexts. Overall, 1-Cyclopropyl-3-piperidinecarboxylic acid represents a versatile scaffold for further chemical exploration and development.

Formula: C₉H₁₅NO₂

InChI: InChI=1S/C9H15NO2/c11-9(12)7-2-1-5-10(6-7)8-3-4-8/h7-8H,1-6H2,(H,11,12)

InChI key: InChIKey=NKYBGCBVGPAMBT-UHFFFAOYSA-N

SMILES: C(O)(=O)C1CN(CCC1)C2CC2

Synonyms:

• 1-Cyclopropyl-3-piperidinecarboxylic acid
• 3-Piperidinecarboxylic acid, 1-cyclopropyl-