CAS 939757-44-5

5,7-Difluoro-2,3-dihydro-3-benzofuranamine

Description:

5,7-Difluoro-2,3-dihydro-3-benzofuranamine is a chemical compound characterized by its unique structure, which includes a benzofuran moiety and two fluorine substituents at the 5 and 7 positions. This compound is classified as an amine due to the presence of an amino group, which can influence its reactivity and interactions with other molecules. The difluorination introduces significant electronegative characteristics, potentially affecting its polarity and solubility in various solvents. The dihydrobenzofuran structure contributes to its stability and may also influence its biological activity. Compounds like this are often of interest in medicinal chemistry for their potential therapeutic applications, particularly in the development of pharmaceuticals. The presence of fluorine atoms can enhance metabolic stability and bioavailability. As with many chemical substances, safety and handling precautions are essential, as the specific toxicity and environmental impact would depend on its concentration and exposure levels. Further studies would be necessary to fully elucidate its properties and potential applications in various fields.

Formula: C₈H₇F₂NO

InChI: InChI=1S/C8H7F2NO/c9-4-1-5-7(11)3-12-8(5)6(10)2-4/h1-2,7H,3,11H2

InChI key: InChIKey=GEGMSPAFIBENDA-UHFFFAOYSA-N

SMILES: FC1=C2C(=CC(F)=C1)C(N)CO2

Synonyms:

• 5,7-Difluoro-2,3-dihydro-3-benzofuranamine
• 3-Benzofuranamine, 5,7-difluoro-2,3-dihydro-