CymitQuimica logo

CAS 939757-45-6

:

1-(Cyclopropylmethyl)-3-piperidinecarboxylic acid

Description:
1-(Cyclopropylmethyl)-3-piperidinecarboxylic acid, identified by its CAS number 939757-45-6, is a chemical compound characterized by its unique structure that includes a piperidine ring and a cyclopropylmethyl group. This compound features a carboxylic acid functional group, which contributes to its acidic properties and potential reactivity. The presence of the piperidine ring suggests that it may exhibit basic characteristics due to the nitrogen atom in the ring, which can participate in protonation. The cyclopropylmethyl substituent adds steric hindrance and may influence the compound's biological activity and interaction with other molecules. Typically, compounds like this can be of interest in medicinal chemistry, particularly in the development of pharmaceuticals, due to their potential to interact with biological targets. Additionally, the compound's solubility, stability, and reactivity can be influenced by its molecular structure, making it a subject of study in various chemical and biological contexts.
Formula:C10H17NO2
InChI:InChI=1S/C10H17NO2/c12-10(13)9-2-1-5-11(7-9)6-8-3-4-8/h8-9H,1-7H2,(H,12,13)
InChI key:InChIKey=APWVQMWNYQLIRM-UHFFFAOYSA-N
SMILES:C(N1CC(C(O)=O)CCC1)C2CC2
Synonyms:
  • 1-(Cyclopropylmethyl)-3-piperidinecarboxylic acid
  • 3-Piperidinecarboxylic acid, 1-(cyclopropylmethyl)-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.