CymitQuimica logo

CAS 939757-61-6

:

(3R,4S)-1-benzyl-4-(3-methoxyphenyl)pyrrolidine-3-carboxylic acid

Description:
(3R,4S)-1-benzyl-4-(3-methoxyphenyl)pyrrolidine-3-carboxylic acid is a chiral compound characterized by its pyrrolidine backbone, which features a benzyl group and a 3-methoxyphenyl substituent. The presence of the carboxylic acid functional group contributes to its acidity and potential for forming salts or esters. The specific stereochemistry, indicated by the (3R,4S) configuration, suggests that the compound may exhibit unique biological activity or pharmacological properties due to its three-dimensional arrangement. This compound may be of interest in medicinal chemistry, particularly in the development of pharmaceuticals, as the chirality can influence the interaction with biological targets. Additionally, the methoxy group can enhance lipophilicity, potentially affecting the compound's solubility and permeability. Overall, this substance's structural features suggest it could play a role in various chemical and biological applications, warranting further investigation into its properties and potential uses.
Formula:C19H21NO3
InChI:InChI=1/C19H21NO3/c1-23-16-9-5-8-15(10-16)17-12-20(13-18(17)19(21)22)11-14-6-3-2-4-7-14/h2-10,17-18H,11-13H2,1H3,(H,21,22)/t17-,18+/m1/s1
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.