CymitQuimica logo

CAS 939757-94-5

:

4-Chloro-N-(cyclopropylmethyl)-2-methylbenzenamine

Description:
4-Chloro-N-(cyclopropylmethyl)-2-methylbenzenamine, identified by its CAS number 939757-94-5, is an organic compound characterized by its aromatic amine structure. It features a chloro substituent at the para position of a methyl-substituted aniline, along with a cyclopropylmethyl group attached to the nitrogen atom. This compound is typically a solid at room temperature and may exhibit moderate solubility in organic solvents, depending on the specific conditions. Its molecular structure suggests potential reactivity due to the presence of the amine group, which can participate in various chemical reactions, including nucleophilic substitutions and coupling reactions. The chloro group may also influence the compound's reactivity and stability. Additionally, the cyclopropylmethyl moiety can impart unique steric and electronic properties, potentially affecting the compound's biological activity and interactions. Overall, this compound may be of interest in medicinal chemistry and material science due to its structural features and potential applications.
Formula:C11H14ClN
InChI:InChI=1S/C11H14ClN/c1-8-6-10(12)4-5-11(8)13-7-9-2-3-9/h4-6,9,13H,2-3,7H2,1H3
InChI key:InChIKey=YHEKXXUEWGYTPF-UHFFFAOYSA-N
SMILES:N(CC1CC1)C2=C(C)C=C(Cl)C=C2
Synonyms:
  • Benzenamine, 4-chloro-N-(cyclopropylmethyl)-2-methyl-
  • 4-Chloro-N-(cyclopropylmethyl)-2-methylbenzenamine
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.