CAS 939757-96-7

N-(Cyclopropylmethyl)-3-(1-methylethyl)benzenamine

Description:

N-(Cyclopropylmethyl)-3-(1-methylethyl)benzenamine, identified by its CAS number 939757-96-7, is an organic compound characterized by its amine functional group attached to a substituted benzene ring. The structure features a cyclopropylmethyl group and an isopropyl group, contributing to its unique steric and electronic properties. This compound is likely to exhibit moderate polarity due to the presence of the amine group, which can engage in hydrogen bonding, influencing its solubility in various solvents. The presence of the cyclopropyl and isopropyl substituents may impart specific reactivity patterns, making it of interest in medicinal chemistry and drug design. Additionally, the compound's molecular structure suggests potential applications in the development of pharmaceuticals or agrochemicals, where the specific arrangement of functional groups can affect biological activity. As with many amines, it may also exhibit basic properties, allowing it to participate in acid-base reactions. Overall, the characteristics of this compound make it a subject of interest for further research in various chemical applications.

Formula: C₁₃H₁₉N

InChI: InChI=1S/C13H19N/c1-10(2)12-4-3-5-13(8-12)14-9-11-6-7-11/h3-5,8,10-11,14H,6-7,9H2,1-2H3

InChI key: InChIKey=LLFFHTMCLGDQEG-UHFFFAOYSA-N

SMILES: N(CC1CC1)C2=CC(C(C)C)=CC=C2

Synonyms:

• N-(Cyclopropylmethyl)-3-(1-methylethyl)benzenamine
• Benzenamine, N-(cyclopropylmethyl)-3-(1-methylethyl)-