CAS 939758-04-0
:2-Chloro-N-[1-(phenylmethyl)-3-pyrrolidinyl]acetamide
Description:
2-Chloro-N-[1-(phenylmethyl)-3-pyrrolidinyl]acetamide is a chemical compound characterized by its unique structure, which includes a chloro group, an acetamide functional group, and a pyrrolidine ring substituted with a phenylmethyl group. This compound typically exhibits properties associated with amides, such as moderate solubility in polar solvents and potential biological activity due to its structural features. The presence of the chloro substituent may influence its reactivity and interaction with biological targets. Additionally, the pyrrolidine ring contributes to its conformational flexibility, which can affect its pharmacological properties. As a compound of interest in medicinal chemistry, it may be studied for its potential therapeutic applications, particularly in the context of central nervous system disorders or as a precursor in synthetic pathways. Safety and handling precautions should be observed, as with any chemical substance, due to potential toxicity or reactivity.
Formula:C13H17ClN2O
InChI:InChI=1S/C13H17ClN2O/c14-8-13(17)15-12-6-7-16(10-12)9-11-4-2-1-3-5-11/h1-5,12H,6-10H2,(H,15,17)
InChI key:InChIKey=HPBWRCHTSALJTF-UHFFFAOYSA-N
SMILES:C(N1CC(NC(CCl)=O)CC1)C2=CC=CC=C2
Synonyms:- Acetamide, 2-chloro-N-[1-(phenylmethyl)-3-pyrrolidinyl]-
- 2-Chloro-N-[1-(phenylmethyl)-3-pyrrolidinyl]acetamide
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.