CAS 939758-08-4
:3-Chloro-6,7-dihydro-4-(trifluoromethyl)-5H-cyclopenta[c]pyridazine
Description:
3-Chloro-6,7-dihydro-4-(trifluoromethyl)-5H-cyclopenta[c]pyridazine is a heterocyclic compound characterized by its unique bicyclic structure, which incorporates both a pyridazine and a cyclopentane moiety. The presence of a chlorine atom and a trifluoromethyl group contributes to its chemical reactivity and potential applications in various fields, including pharmaceuticals and agrochemicals. This compound is typically a solid at room temperature and may exhibit moderate solubility in organic solvents. Its trifluoromethyl group enhances lipophilicity, which can influence its biological activity and interaction with biological targets. The chlorine substituent can also affect the compound's electronic properties, potentially altering its reactivity and stability. As with many heterocycles, the compound may exhibit interesting pharmacological properties, making it a subject of interest in medicinal chemistry. Safety and handling precautions should be observed due to the presence of halogenated groups, which can pose environmental and health risks.
Formula:C8H6ClF3N2
InChI:InChI=1S/C8H6ClF3N2/c9-7-6(8(10,11)12)4-2-1-3-5(4)13-14-7/h1-3H2
InChI key:InChIKey=WINVJBBGILNSLQ-UHFFFAOYSA-N
SMILES:C(F)(F)(F)C1=C2C(=NN=C1Cl)CCC2
Synonyms:- 5H-Cyclopenta[c]pyridazine, 3-chloro-6,7-dihydro-4-(trifluoromethyl)-
- 3-Chloro-6,7-dihydro-4-(trifluoromethyl)-5H-cyclopenta[c]pyridazine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.