CAS 939758-10-8

α-Phenyl-2-(trifluoromethyl)-1H-benzimidazole-6-methanamine

Description:

α-Phenyl-2-(trifluoromethyl)-1H-benzimidazole-6-methanamine, with the CAS number 939758-10-8, is a chemical compound characterized by its unique structural features, including a benzimidazole core substituted with a phenyl group and a trifluoromethyl group. This compound typically exhibits properties associated with both aromatic and heterocyclic compounds, such as stability and potential biological activity. The presence of the trifluoromethyl group often enhances lipophilicity and can influence the compound's reactivity and interaction with biological targets. Additionally, the amine functional group may contribute to its basicity and ability to form hydrogen bonds, which can be significant in pharmacological contexts. The compound's specific applications and behavior in various environments would depend on its solubility, stability under different conditions, and interactions with other chemical species. Overall, α-Phenyl-2-(trifluoromethyl)-1H-benzimidazole-6-methanamine represents a class of compounds that may have potential uses in medicinal chemistry and material science.

Formula: C₁₅H₁₂F₃N₃

InChI: InChI=1S/C15H12F3N3/c16-15(17,18)14-20-11-7-6-10(8-12(11)21-14)13(19)9-4-2-1-3-5-9/h1-8,13H,19H2,(H,20,21)

InChI key: InChIKey=MWNJYDIIEMBKTE-UHFFFAOYSA-N

SMILES: C(N)(C=1C=C2C(N=C(C(F)(F)F)N2)=CC1)C3=CC=CC=C3

Synonyms:

• α-Phenyl-2-(trifluoromethyl)-1H-benzimidazole-6-methanamine
• 1H-Benzimidazole-6-methanamine, α-phenyl-2-(trifluoromethyl)-