CAS 939758-13-1
:methyl 4-(4-fluorophenyl)pyrrolidine-3-carboxylate
Description:
Methyl 4-(4-fluorophenyl)pyrrolidine-3-carboxylate, identified by its CAS number 939758-13-1, is a chemical compound characterized by its pyrrolidine structure, which is a five-membered nitrogen-containing ring. This compound features a carboxylate functional group, contributing to its reactivity and potential applications in organic synthesis. The presence of a fluorophenyl group enhances its lipophilicity and may influence its biological activity, making it of interest in medicinal chemistry. The methyl ester group indicates that it can undergo hydrolysis to yield the corresponding carboxylic acid, which may have different properties and reactivity. Methyl 4-(4-fluorophenyl)pyrrolidine-3-carboxylate is likely to be a solid at room temperature, with specific melting and boiling points dependent on its purity and crystalline form. Its synthesis and characterization would typically involve standard organic chemistry techniques, and it may be utilized in the development of pharmaceuticals or agrochemicals due to its structural features. Safety data should be consulted for handling and storage, as with any chemical substance.
Formula:C12H14FNO2
InChI:InChI=1/C12H14FNO2/c1-16-12(15)11-7-14-6-10(11)8-2-4-9(13)5-3-8/h2-5,10-11,14H,6-7H2,1H3
SMILES:COC(=O)C1CNCC1c1ccc(cc1)F
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
Methyl 4-(4-fluorophenyl)pyrrolidine-3-carboxylate
CAS:<p>Methyl 4-(4-fluorophenyl)pyrrolidine-3-carboxylate</p>Molecular weight:223.24346g/mol

