CymitQuimica logo

CAS 939758-19-7

:

Methyl 4-(3-fluorophenyl)-3-pyrrolidinecarboxylate

Description:
Methyl 4-(3-fluorophenyl)-3-pyrrolidinecarboxylate, identified by its CAS number 939758-19-7, is a chemical compound characterized by its pyrrolidine ring structure, which is a five-membered nitrogen-containing heterocycle. This compound features a methyl ester functional group, contributing to its reactivity and solubility properties. The presence of a 3-fluorophenyl group indicates that it has a fluorine atom substituted on the aromatic ring, which can influence its electronic properties and biological activity. Methyl esters are generally known for their moderate polarity, making them soluble in organic solvents while having limited solubility in water. The compound may exhibit interesting pharmacological properties due to its structural features, making it a subject of interest in medicinal chemistry. Additionally, the specific arrangement of atoms and functional groups can affect its interactions with biological targets, potentially leading to applications in drug development or as a synthetic intermediate in organic synthesis. As with any chemical, proper handling and safety precautions should be observed due to potential hazards associated with its use.
Formula:C12H14FNO2
InChI:InChI=1S/C12H14FNO2/c1-16-12(15)11-7-14-6-10(11)8-3-2-4-9(13)5-8/h2-5,10-11,14H,6-7H2,1H3
InChI key:InChIKey=DHNONVNQXOJHJT-UHFFFAOYSA-N
SMILES:C(OC)(=O)C1C(CNC1)C2=CC(F)=CC=C2
Synonyms:
  • 3-Pyrrolidinecarboxylic acid, 4-(3-fluorophenyl)-, methyl ester
  • Methyl 4-(3-fluorophenyl)-3-pyrrolidinecarboxylate
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.