CAS 939758-72-2

5-Quinolinecarbonitrile, 1,2,3,4-tetrahydro-

Description:

5-Quinolinecarbonitrile, 1,2,3,4-tetrahydro- is a heterocyclic organic compound characterized by its quinoline structure, which consists of a fused bicyclic system containing a benzene ring and a pyridine ring. The presence of a carbonitrile group (-C≡N) contributes to its reactivity and potential applications in various chemical reactions. This compound is typically a colorless to pale yellow solid and is soluble in organic solvents. Its tetrahydro derivative indicates that it has undergone hydrogenation, resulting in a saturated structure that can influence its chemical properties and biological activity. The compound may exhibit interesting pharmacological properties, making it a subject of interest in medicinal chemistry. Additionally, its unique structure allows for potential applications in the development of agrochemicals, dyes, or as intermediates in organic synthesis. Safety data and handling precautions should be considered, as with any chemical substance, to ensure proper laboratory practices.

Formula: C₁₀H₁₀N₂

InChI: InChI=1S/C10H10N2/c11-7-8-3-1-5-10-9(8)4-2-6-12-10/h1,3,5,12H,2,4,6H2

InChI key: InChIKey=ZAEOGUPVWLRFEK-UHFFFAOYSA-N

SMILES: C(#N)C1=C2C(=CC=C1)NCCC2

Synonyms:

• 1,2,3,4-Tetrahydroquinoline-5-carbonitrile
• 5-Quinolinecarbonitrile, 1,2,3,4-tetrahydro-

1,2,3,4-Tetrahydroquinoline-5-carbonitrile

CAS: 939758-72-2

Versatile small molecule scaffold

Formula: C₁₀H₁₀N₂

Purity: Min. 95%

Molecular weight: 158.2 g/mol

Ref: 3D-PMB75872