CAS 939758-74-4

5-(trifluoromethyl)-1,2,3,4-tetrahydroquinoline hydrochloride

Description:

5-(Trifluoromethyl)-1,2,3,4-tetrahydroquinoline hydrochloride is a chemical compound characterized by its unique structure, which includes a tetrahydroquinoline core substituted with a trifluoromethyl group. This substitution enhances its lipophilicity and may influence its biological activity. The hydrochloride form indicates that the compound is a salt, which typically improves its solubility in water and stability. The presence of the trifluoromethyl group often imparts distinctive electronic properties, making it of interest in medicinal chemistry and drug design. Compounds like this may exhibit various pharmacological activities, including potential applications in treating neurological disorders or as intermediates in organic synthesis. The compound's molecular weight, melting point, and specific reactivity would depend on its precise structure and the conditions under which it is handled. As with many chemical substances, safety data sheets should be consulted for handling and toxicity information, as the trifluoromethyl group can also pose environmental and health risks.

Formula: C₁₀H₁₁ClF₃N

InChI: InChI=1/C10H10F3N.ClH/c11-10(12,13)8-4-1-5-9-7(8)3-2-6-14-9;/h1,4-5,14H,2-3,6H2;1H

SMILES: c1cc(c2CCCNc2c1)C(F)(F)F.Cl