CAS 939759-03-2
:4-iodo-2,3-dihydro-1H-indole
Description:
4-Iodo-2,3-dihydro-1H-indole is a chemical compound characterized by its indole structure, which consists of a fused benzene and pyrrole ring. The presence of an iodine atom at the 4-position of the indole ring significantly influences its reactivity and properties. This compound is typically a solid at room temperature and may exhibit a range of colors depending on its purity and form. It is known for its potential applications in medicinal chemistry, particularly in the development of pharmaceuticals due to the biological activity associated with indole derivatives. The dihydro form indicates that it has two hydrogen atoms added to the double bond in the pyrrole part of the indole, which can affect its stability and reactivity. Additionally, the iodine substituent can enhance the compound's electrophilic character, making it useful in various chemical reactions, including coupling reactions and as a precursor for further synthetic modifications. As with many halogenated compounds, it is essential to handle 4-iodo-2,3-dihydro-1H-indole with care due to potential toxicity and environmental concerns.
Formula:C8H8IN
InChI:InChI=1/C8H8IN/c9-7-2-1-3-8-6(7)4-5-10-8/h1-3,10H,4-5H2
SMILES:c1cc(c2CCNc2c1)I
Synonyms:- 4-Iodoindoline
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
