CAS 939759-26-9

benzyl 3-iodoazetidine-1-carboxylate

Description:

Benzyl 3-iodoazetidine-1-carboxylate is a chemical compound characterized by its azetidine ring structure, which is a four-membered saturated heterocycle containing one nitrogen atom. The presence of the benzyl group indicates that a benzene ring is attached to the nitrogen atom, contributing to the compound's aromatic properties. The iodo substituent at the 3-position of the azetidine ring enhances its reactivity, making it useful in various synthetic applications, particularly in medicinal chemistry. The carboxylate functional group at the 1-position provides acidic characteristics, allowing for potential interactions in biological systems. This compound may exhibit interesting pharmacological properties due to its unique structural features, which can influence its behavior in chemical reactions and biological interactions. Its CAS number, 939759-26-9, allows for easy identification and retrieval of information in chemical databases. Overall, benzyl 3-iodoazetidine-1-carboxylate is a versatile compound with potential applications in organic synthesis and drug development.

Formula: C₁₁H₁₂INO₂

InChI: InChI=1/C11H12INO2/c12-10-6-13(7-10)11(14)15-8-9-4-2-1-3-5-9/h1-5,10H,6-8H2

SMILES: c1ccc(cc1)COC(=O)N1CC(C1)I

Synonyms:

• 1-Cbz-3-iodo-azetidine

Benzyl 3-iodoazetidine-1-carboxylate

CAS: 939759-26-9

Formula: C₁₁H₁₂INO₂

Purity: 97%

Color and Shape: Liquid

Molecular weight: 317.1230

Ref: IN-DA005WRI

1-Cbz-3-iodoazetidine

CAS: 939759-26-9

1-Cbz-3-iodoazetidine

Purity: 98%

Molecular weight: 317.12g/mol

Ref: 54-OR317157

Benzyl 3-iodoazetidine-1-carboxylate

CAS: 939759-26-9

Formula: C₁₁H₁₂INO₂

Purity: 95%

Color and Shape: Liquid

Molecular weight: 317.126

Ref: 10-F230044

Benzyl 3-iodoazetidine-1-carboxylate

CAS: 939759-26-9

Versatile small molecule scaffold

Formula: C₁₁H₁₂INO₂

Purity: Min. 95%

Molecular weight: 317.13 g/mol

Ref: 3D-PMB75926