
CAS 939760-43-7
:1,1-Dimethylethyl N-[2-amino-2-(2-nitrophenyl)ethyl]carbamate
Description:
1,1-Dimethylethyl N-[2-amino-2-(2-nitrophenyl)ethyl]carbamate, identified by its CAS number 939760-43-7, is a chemical compound that features a carbamate functional group. This substance is characterized by the presence of a dimethyl group attached to a tertiary carbon, which contributes to its steric hindrance and potentially influences its reactivity and solubility. The compound also contains an amino group and a nitrophenyl moiety, which can impart specific electronic properties and enhance its biological activity. The nitro group is known for its electron-withdrawing effects, which can affect the compound's interaction with biological targets. Additionally, the presence of the amino group suggests potential for hydrogen bonding, which may influence its solubility in polar solvents. Overall, the unique combination of functional groups in this compound suggests it may have applications in medicinal chemistry or as a biochemical probe, although specific biological activities would require further investigation.
Formula:C13H19N3O4
InChI:InChI=1S/C13H19N3O4/c1-13(2,3)20-12(17)15-8-10(14)9-6-4-5-7-11(9)16(18)19/h4-7,10H,8,14H2,1-3H3,(H,15,17)
InChI key:InChIKey=SSKKKECXJUIGLV-UHFFFAOYSA-N
SMILES:C(CNC(OC(C)(C)C)=O)(N)C1=C(N(=O)=O)C=CC=C1
Synonyms:- 1,1-Dimethylethyl N-[2-amino-2-(2-nitrophenyl)ethyl]carbamate
- Carbamic acid, N-[2-amino-2-(2-nitrophenyl)ethyl]-, 1,1-dimethylethyl ester
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.