CAS 939760-57-3

1,1-Dimethylethyl N-[2-amino-2-(2,4-dichlorophenyl)ethyl]carbamate

Description:

1,1-Dimethylethyl N-[2-amino-2-(2,4-dichlorophenyl)ethyl]carbamate, identified by its CAS number 939760-57-3, is a chemical compound that belongs to the class of carbamates. This substance features a complex structure characterized by the presence of a tert-butyl group, which contributes to its steric hindrance, and an amino group that is linked to a dichlorophenyl moiety, enhancing its potential biological activity. The dichlorophenyl group introduces significant hydrophobic characteristics, which can influence the compound's solubility and interaction with biological systems. The carbamate functional group is known for its reactivity and potential applications in various fields, including pharmaceuticals and agrochemicals. This compound may exhibit specific pharmacological properties, making it of interest in medicinal chemistry. However, detailed studies on its toxicity, environmental impact, and specific applications would be necessary to fully understand its characteristics and potential uses. As with all chemical substances, proper handling and safety measures should be observed when working with this compound.

Formula: C₁₃H₁₈Cl₂N₂O₂

InChI: InChI=1S/C13H18Cl2N2O2/c1-13(2,3)19-12(18)17-7-11(16)9-5-4-8(14)6-10(9)15/h4-6,11H,7,16H2,1-3H3,(H,17,18)

InChI key: InChIKey=CGCRUHRFBBMTQY-UHFFFAOYSA-N

SMILES: C(CNC(OC(C)(C)C)=O)(N)C1=C(Cl)C=C(Cl)C=C1

Synonyms:

• Carbamic acid, N-[2-amino-2-(2,4-dichlorophenyl)ethyl]-, 1,1-dimethylethyl ester
• 1,1-Dimethylethyl N-[2-amino-2-(2,4-dichlorophenyl)ethyl]carbamate