CymitQuimica logo

CAS 939761-08-7

:

Methyl 4′-(chlorosulfonyl)[1,1′-biphenyl]-3-carboxylate

Description:
Methyl 4′-(chlorosulfonyl)[1,1′-biphenyl]-3-carboxylate is a chemical compound characterized by its complex structure, which includes a biphenyl moiety substituted with a chlorosulfonyl group and a carboxylate ester. This compound typically exhibits properties associated with both aromatic and sulfonyl functionalities, which can influence its reactivity and solubility. The presence of the chlorosulfonyl group suggests potential applications in sulfonation reactions or as an electrophilic reagent in organic synthesis. The methyl ester group indicates that it can undergo hydrolysis to yield the corresponding carboxylic acid. Additionally, the biphenyl structure may impart certain electronic properties, making it useful in various chemical applications, including pharmaceuticals and agrochemicals. Safety data should be consulted, as compounds with sulfonyl and chlorinated groups can pose health hazards. Overall, Methyl 4′-(chlorosulfonyl)[1,1′-biphenyl]-3-carboxylate is a versatile compound with potential utility in synthetic organic chemistry.
Formula:C14H11ClO4S
InChI:InChI=1S/C14H11ClO4S/c1-19-14(16)12-4-2-3-11(9-12)10-5-7-13(8-6-10)20(15,17)18/h2-9H,1H3
InChI key:InChIKey=HYZBNCCZGMNGPM-UHFFFAOYSA-N
SMILES:C(OC)(=O)C=1C=C(C=CC1)C2=CC=C(S(Cl)(=O)=O)C=C2
Synonyms:
  • [1,1′-Biphenyl]-3-carboxylic acid, 4′-(chlorosulfonyl)-, methyl ester
  • Methyl 4′-(chlorosulfonyl)[1,1′-biphenyl]-3-carboxylate
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.