
CAS 939762-12-6
:4-(Methoxymethyl)-6-[(4-methylphenyl)thio]-2-phenylpyrimidine
Description:
4-(Methoxymethyl)-6-[(4-methylphenyl)thio]-2-phenylpyrimidine is a chemical compound characterized by its pyrimidine core, which is a six-membered heterocyclic ring containing two nitrogen atoms at positions 1 and 3. This compound features a methoxymethyl group at the 4-position, which enhances its solubility and reactivity. The presence of a thioether group, specifically a 4-methylphenylthio substituent at the 6-position, contributes to its potential biological activity and may influence its electronic properties. The phenyl group at the 2-position adds to the compound's hydrophobic character, which can affect its interaction with biological membranes. Overall, this compound's structural features suggest potential applications in medicinal chemistry, particularly in the development of pharmaceuticals targeting specific biological pathways. Its unique combination of functional groups may also allow for further modifications to optimize its efficacy and selectivity in various chemical reactions or biological systems.
Formula:C19H18N2OS
InChI:InChI=1S/C19H18N2OS/c1-14-8-10-17(11-9-14)23-18-12-16(13-22-2)20-19(21-18)15-6-4-3-5-7-15/h3-12H,13H2,1-2H3
InChI key:InChIKey=YJAVWYQNIQRGKC-UHFFFAOYSA-N
SMILES:S(C1=NC(=NC(COC)=C1)C2=CC=CC=C2)C3=CC=C(C)C=C3
Synonyms:- Pyrimidine, 4-(methoxymethyl)-6-[(4-methylphenyl)thio]-2-phenyl-
- 4-(Methoxymethyl)-6-[(4-methylphenyl)thio]-2-phenylpyrimidine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.