CymitQuimica logo

CAS 939793-58-5

:

Hexahydro-2-(phenylmethyl)-1H-pyrrolo[3,4-c]pyridine-1,3(2H)-dione

Description:
Hexahydro-2-(phenylmethyl)-1H-pyrrolo[3,4-c]pyridine-1,3(2H)-dione, with the CAS number 939793-58-5, is a chemical compound characterized by its complex bicyclic structure, which includes a pyrrolidine and a pyridine ring. This compound features a hexahydro configuration, indicating that it is fully saturated with hydrogen atoms, contributing to its stability and solubility in various solvents. The presence of a phenylmethyl group enhances its lipophilicity, potentially influencing its biological activity and interactions with other molecules. The dione functional groups suggest that it may participate in various chemical reactions, including nucleophilic attacks and hydrogen bonding. This compound may exhibit pharmacological properties, making it of interest in medicinal chemistry and drug development. Its unique structure allows for potential applications in various fields, including organic synthesis and material science. However, specific biological activities, toxicity, and environmental impact would require further investigation through empirical studies.
Formula:C14H16N2O2
InChI:InChI=1S/C14H16N2O2/c17-13-11-6-7-15-8-12(11)14(18)16(13)9-10-4-2-1-3-5-10/h1-5,11-12,15H,6-9H2
InChI key:InChIKey=QHLLSQQQAYMXAK-UHFFFAOYSA-N
SMILES:O=C1C2C(C(=O)N1CC3=CC=CC=C3)CNCC2
Synonyms:
  • Hexahydro-2-(phenylmethyl)-1H-pyrrolo[3,4-c]pyridine-1,3(2H)-dione
  • 2-Benzylhexahydro-1H-pyrrolo[3,4-c]pyridine-1,3(2H)-dione
  • 2-Benzyl-3a,4,5,6,7,7a-hexahydropyrrolo[3,4-c]pyridine-1,3-dione
  • 1H-Pyrrolo[3,4-c]pyridine-1,3(2H)-dione, hexahydro-2-(phenylmethyl)-
  • 2-Benzyl-octahydro-1H-pyrrolo[3,4-c]pyridine-1,3-dione
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.