
CAS 939793-65-4
:1-(Chloromethyl)-1-methylcyclohexane
Description:
1-(Chloromethyl)-1-methylcyclohexane is an organic compound characterized by its cyclohexane structure with a chloromethyl group and a methyl group attached to the same carbon atom. This compound features a saturated cyclohexane ring, which contributes to its stability and hydrophobic nature. The presence of the chloromethyl group introduces a polar functional group, making the compound more reactive and capable of participating in nucleophilic substitution reactions. Its molecular structure suggests that it may exhibit moderate volatility and solubility in organic solvents, while being less soluble in water due to its hydrophobic cyclohexane framework. The compound's reactivity can be influenced by the steric hindrance provided by the methyl group, which may affect its interactions with nucleophiles. Additionally, 1-(Chloromethyl)-1-methylcyclohexane can serve as an intermediate in organic synthesis, particularly in the production of more complex molecules. Safety considerations should be taken into account, as chlorinated compounds can pose health risks and environmental concerns.
Formula:C8H15Cl
InChI:InChI=1S/C8H15Cl/c1-8(7-9)5-3-2-4-6-8/h2-7H2,1H3
InChI key:InChIKey=AGEORGJXZRDUIV-UHFFFAOYSA-N
SMILES:C(Cl)C1(C)CCCCC1
Synonyms:- 1-(Chloromethyl)-1-methylcyclohexane
- Cyclohexane, 1-(chloromethyl)-1-methyl-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.