CAS 93980-76-8

N-D-gluconoyl-L-glutamic acid

Description:

N-D-gluconoyl-L-glutamic acid is a chemical compound characterized by its structure, which includes a glutamic acid moiety modified by the addition of a gluconoyl group. This modification enhances its solubility and potential bioactivity. The compound is typically classified as an amino acid derivative and may exhibit properties such as being a chelating agent or having potential applications in pharmaceuticals and biochemistry. Its molecular structure allows for interactions with various biological systems, making it of interest in research related to drug delivery and metabolic processes. The presence of both carboxylic acid and amine functional groups contributes to its ability to form salts and participate in various chemical reactions. Additionally, N-D-gluconoyl-L-glutamic acid may be studied for its role in enhancing the stability and efficacy of therapeutic agents. As with many compounds, its safety and efficacy would need to be evaluated in specific applications, particularly in the context of human health and environmental impact.

Formula: C₁₁H₁₉NO₁₀

InChI: InChI=1S/C11H19NO10/c13-3-5(14)7(17)8(18)9(19)10(20)12-4(11(21)22)1-2-6(15)16/h4-5,7-9,13-14,17-19H,1-3H2,(H,12,20)(H,15,16)(H,21,22)/t4-,5+,7+,8-,9+/m0/s1

InChI key: InChIKey=RALMEYHIPGGEHB-MLBSCHOTSA-N

SMILES: [C@H](NC([C@@H]([C@H]([C@@H]([C@@H](CO)O)O)O)O)=O)(CCC(O)=O)C(O)=O

Synonyms:

• L-Glutamic acid, N-D-gluconoyl-
• N-D-Gluconoyl-L-glutamic acid
• N-(D-Glucos-1-yl)-L-glutamic acid
• N-D-Gluconoyl-

N-D-Gluconoyl-L-glutamic Acid

Controlled Product

CAS: 93980-76-8

Formula: C₁₁H₁₉NO₁₀

Color and Shape: Neat

Molecular weight: 325.269

Ref: TR-G417500