CAS 939801-40-8

4-(3-Fluorophenyl)tetrahydro-2H-thiopyran-4-ol

Description:

4-(3-Fluorophenyl)tetrahydro-2H-thiopyran-4-ol is a chemical compound characterized by its unique structure, which includes a tetrahydrothiopyran ring and a fluorophenyl substituent. The presence of the fluorine atom in the aromatic ring can influence the compound's electronic properties, potentially enhancing its reactivity and solubility in various solvents. This compound features a hydroxyl group (-OH) that contributes to its polarity and can participate in hydrogen bonding, affecting its physical properties such as boiling and melting points. The thiopyran ring structure may impart specific stereochemical characteristics, influencing its biological activity and interactions with other molecules. As a result, compounds like this may be of interest in medicinal chemistry and drug development, particularly in the search for new therapeutic agents. Additionally, the compound's stability, reactivity, and potential applications can be further explored through various analytical techniques, including NMR spectroscopy and mass spectrometry, to elucidate its properties and behavior in different environments.

Formula: C₁₁H₁₃FOS

InChI: InChI=1S/C11H13FOS/c12-10-3-1-2-9(8-10)11(13)4-6-14-7-5-11/h1-3,8,13H,4-7H2

InChI key: InChIKey=XXUAXEJPAIZBNA-UHFFFAOYSA-N

SMILES: OC1(C2=CC(F)=CC=C2)CCSCC1

Synonyms:

• 4-(3-Fluorophenyl)tetrahydro-2H-thiopyran-4-ol
• 2H-Thiopyran-4-ol, 4-(3-fluorophenyl)tetrahydro-