CAS 939803-90-4

6-Bromo-5-methoxybenzothiazole

Description:

6-Bromo-5-methoxybenzothiazole is an organic compound characterized by its unique structure, which includes a benzothiazole ring system substituted with a bromine atom and a methoxy group. The presence of the bromine atom typically enhances the compound's reactivity and can influence its biological activity, making it of interest in medicinal chemistry. The methoxy group, on the other hand, can affect the compound's solubility and electronic properties. This compound is often studied for its potential applications in pharmaceuticals, particularly in the development of new therapeutic agents. Its molecular structure contributes to its properties, such as melting point, boiling point, and solubility, which are essential for understanding its behavior in various chemical environments. Additionally, the compound may exhibit specific interactions with biological targets, making it a candidate for further research in drug discovery and development. As with many benzothiazole derivatives, it may also possess fluorescent properties, which can be useful in various analytical applications.

Formula: C₈H₆BrNOS

InChI: InChI=1S/C8H6BrNOS/c1-11-7-3-6-8(2-5(7)9)12-4-10-6/h2-4H,1H3

InChI key: InChIKey=DQPKSFXGLOCICG-UHFFFAOYSA-N

SMILES: O(C)C=1C=C2C(=CC1Br)SC=N2

Synonyms:

• Benzothiazole, 6-bromo-5-methoxy-
• 6-Bromo-5-methoxybenzothiazole