
CAS 93982-05-9
:3,4-Dihydro-5-hydroxy-2(1H)-isoquinolinecarboxaldehyde
Description:
3,4-Dihydro-5-hydroxy-2(1H)-isoquinolinecarboxaldehyde, with the CAS number 93982-05-9, is a chemical compound that belongs to the isoquinoline family. This substance features a bicyclic structure characterized by a fused benzene and pyridine ring, which contributes to its unique chemical properties. The presence of a hydroxyl group (-OH) at the 5-position and an aldehyde group (-CHO) at the 2-position enhances its reactivity and potential for forming hydrogen bonds. This compound is typically a solid at room temperature and is soluble in polar solvents due to its functional groups. It may exhibit biological activity, making it of interest in medicinal chemistry and pharmacology. The compound's structural features suggest potential applications in the development of pharmaceuticals, particularly in the context of neuroactive compounds or as intermediates in organic synthesis. However, specific biological activities and applications would require further investigation through empirical studies.
Formula:C10H11NO2
InChI:InChI=1S/C10H11NO2/c12-7-11-5-4-9-8(6-11)2-1-3-10(9)13/h1-3,7,13H,4-6H2
InChI key:InChIKey=REHVPMWAQZHMID-UHFFFAOYSA-N
SMILES:OC1=C2C(CN(C=O)CC2)=CC=C1
Synonyms:- 3,4-Dihydro-5-hydroxy-2(1H)-isoquinolinecarboxaldehyde
- 2(1H)-Isoquinolinecarboxaldehyde, 3,4-dihydro-5-hydroxy-
- 3,4-Dihydro-5-hydroxy-(1H)-isoquinoline-2-carbaldehyde
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.