CAS 93982-47-9
:Methyl 4-(1,1,2,2-tetrafluoroethoxy)benzoate
Description:
Methyl 4-(1,1,2,2-tetrafluoroethoxy)benzoate is an organic compound characterized by its ester functional group, which is derived from benzoic acid and methanol. This compound features a tetrafluoroethoxy group, contributing to its unique properties, including increased hydrophobicity and potential applications in various chemical processes. The presence of fluorine atoms enhances its thermal stability and chemical resistance, making it suitable for use in specialized formulations, such as in the production of fluorinated polymers or as a solvent in organic synthesis. The molecular structure includes a benzene ring substituted with both the ester group and the tetrafluoroethoxy moiety, which can influence its reactivity and interaction with other substances. Methyl 4-(1,1,2,2-tetrafluoroethoxy)benzoate is typically handled with care due to its potential environmental impact and the need for proper safety measures during its use in laboratory or industrial settings. Overall, its unique characteristics make it a compound of interest in both research and industrial applications.
Formula:C10H8F4O3
InChI:InChI=1S/C10H8F4O3/c1-16-8(15)6-2-4-7(5-3-6)17-10(13,14)9(11)12/h2-5,9H,1H3
InChI key:InChIKey=XBSLEPDQBBJDSJ-UHFFFAOYSA-N
SMILES:O(C(C(F)F)(F)F)C1=CC=C(C(OC)=O)C=C1
Synonyms:- Benzoic acid, 4-(1,1,2,2-tetrafluoroethoxy)-, methyl ester
- HFE-994Mp
- Methyl 4-(1,1,2,2-tetrafluoroethoxy)benzoate
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.