CAS 93982-56-0
:2-Hydroxy-1,2-bis(3-phenoxyphenyl)ethanone
Description:
2-Hydroxy-1,2-bis(3-phenoxyphenyl)ethanone, with the CAS number 93982-56-0, is an organic compound characterized by its complex structure featuring a hydroxy group and two phenoxyphenyl groups attached to an ethanone backbone. This compound typically exhibits properties such as being a solid at room temperature, with potential applications in various fields, including pharmaceuticals and materials science. Its molecular structure suggests it may possess significant aromatic character, contributing to its stability and potential reactivity. The presence of the hydroxy group indicates it may engage in hydrogen bonding, influencing its solubility and interaction with other substances. Additionally, the phenoxy groups can enhance its lipophilicity, making it suitable for incorporation into formulations requiring specific solubility profiles. Overall, 2-Hydroxy-1,2-bis(3-phenoxyphenyl)ethanone is a compound of interest due to its unique structural features and potential utility in diverse chemical applications.
Formula:C26H20O4
InChI:InChI=1S/C26H20O4/c27-25(19-9-7-15-23(17-19)29-21-11-3-1-4-12-21)26(28)20-10-8-16-24(18-20)30-22-13-5-2-6-14-22/h1-18,25,27H
InChI key:InChIKey=DDDGBXZGYPJRKI-UHFFFAOYSA-N
SMILES:C(C(=O)C1=CC(OC2=CC=CC=C2)=CC=C1)(O)C3=CC(OC4=CC=CC=C4)=CC=C3
Synonyms:- 2-Hydroxy-1,2-Bis(3-Phenoxyphenyl)Ethanone
- Ethanone, 2-hydroxy-1,2-bis(3-phenoxyphenyl)-
- 2-Hydroxy-1,2-bis(3-phenoxyphenyl)ethan-1-one
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
2-Hydroxy-1,2-bis(3-phenoxyphenyl)ethanone
CAS:Controlled ProductFormula:C26H20O4Color and Shape:NeatMolecular weight:396.435
