CAS 93988-27-3

2-amino-N-(2,4-dimethoxyphenyl)benzamide

Description:

2-amino-N-(2,4-dimethoxyphenyl)benzamide, with the CAS number 93988-27-3, is an organic compound characterized by its amide functional group and the presence of an amino group. This compound features a benzamide structure, where the amide nitrogen is substituted with a 2,4-dimethoxyphenyl group, contributing to its unique chemical properties. The presence of methoxy groups enhances its solubility in organic solvents and may influence its reactivity and biological activity. Typically, compounds like this can exhibit various pharmacological properties, making them of interest in medicinal chemistry. The molecular structure suggests potential interactions with biological targets, which could be explored in drug development. Additionally, the compound's stability, melting point, and solubility characteristics would depend on its specific molecular interactions and the environment in which it is studied. Overall, 2-amino-N-(2,4-dimethoxyphenyl)benzamide represents a class of compounds that may have significant applications in research and industry, particularly in the fields of pharmaceuticals and organic synthesis.

Formula: C₁₅H₁₆N₂O₃

InChI: InChI=1/C15H16N2O3/c1-19-10-7-8-13(14(9-10)20-2)17-15(18)11-5-3-4-6-12(11)16/h3-9H,16H2,1-2H3,(H,17,18)

SMILES: COc1ccc(c(c1)OC)N=C(c1ccccc1N)O

Synonyms:

• 2-Amino-N-(2,4-dimethoxy-phenyl)-benzamide
• benzamide, 2-amino-N-(2,4-dimethoxyphenyl)-

2-Amino-N-(2,4-dimethoxyphenyl)benzamide

CAS: 93988-27-3

Versatile small molecule scaffold

Formula: C₁₅H₁₆N₂O₃

Purity: Min. 95%

Molecular weight: 272.3 g/mol

Ref: 3D-TDA98827