
CAS 939986-01-3
:4-Chloro-N-(3-piperidinylmethyl)-2-pyrimidinamine
Description:
4-Chloro-N-(3-piperidinylmethyl)-2-pyrimidinamine is a chemical compound characterized by its pyrimidine and piperidine moieties. It features a chloro substituent at the 4-position of the pyrimidine ring and a piperidinylmethyl group attached to the nitrogen at the 2-position. This structure suggests potential biological activity, particularly in medicinal chemistry, where such compounds may exhibit properties as enzyme inhibitors or receptor modulators. The presence of the piperidine ring contributes to its lipophilicity, which can influence its pharmacokinetic properties, such as absorption and distribution in biological systems. Additionally, the chloro group may enhance the compound's reactivity and interaction with biological targets. The compound's molecular weight, solubility, and stability are also important characteristics that can affect its application in research and development. Overall, 4-Chloro-N-(3-piperidinylmethyl)-2-pyrimidinamine represents a class of compounds that may have significant implications in drug discovery and development.
Formula:C10H15ClN4
InChI:InChI=1S/C10H15ClN4/c11-9-3-5-13-10(15-9)14-7-8-2-1-4-12-6-8/h3,5,8,12H,1-2,4,6-7H2,(H,13,14,15)
InChI key:InChIKey=VGHGMFUIGHHBSP-UHFFFAOYSA-N
SMILES:N(CC1CCCNC1)C=2N=C(Cl)C=CN2
Synonyms:- 4-Chloro-N-(3-piperidinylmethyl)-2-pyrimidinamine
- 2-Pyrimidinamine, 4-chloro-N-(3-piperidinylmethyl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.