CAS 939986-03-5

1-(2-Pyrazinyl)-3-piperidinemethanol

Description:

1-(2-Pyrazinyl)-3-piperidinemethanol is a chemical compound characterized by its unique structure, which includes a pyrazine ring and a piperidine moiety. The presence of the pyrazine ring contributes to its potential biological activity, as heterocyclic compounds often exhibit diverse pharmacological properties. The piperidine portion of the molecule provides a basic nitrogen atom, which can participate in hydrogen bonding and influence the compound's solubility and reactivity. This compound is typically a solid at room temperature and may exhibit moderate to high polarity due to the hydroxyl group (-OH) attached to the piperidine. Its molecular interactions can be significant in drug design, particularly in the development of pharmaceuticals targeting central nervous system disorders or other therapeutic areas. The compound's CAS number, 939986-03-5, allows for easy identification and retrieval of information regarding its synthesis, safety data, and potential applications in research and industry. As with any chemical substance, proper handling and safety precautions should be observed.

Formula: C₁₀H₁₅N₃O

InChI: InChI=1S/C10H15N3O/c14-8-9-2-1-5-13(7-9)10-6-11-3-4-12-10/h3-4,6,9,14H,1-2,5,7-8H2

InChI key: InChIKey=NNAGKHZEZRAOFN-UHFFFAOYSA-N

SMILES: C(O)C1CN(CCC1)C=2C=NC=CN2

Synonyms:

• 3-Piperidinemethanol, 1-(2-pyrazinyl)-
• 1-(2-Pyrazinyl)-3-piperidinemethanol