CAS 939986-04-6

1,1-Dimethylethyl 3-[(3-chloro-2-quinoxalinyl)amino]-1-piperidinecarboxylate

Description:

1,1-Dimethylethyl 3-[(3-chloro-2-quinoxalinyl)amino]-1-piperidinecarboxylate, identified by its CAS number 939986-04-6, is a chemical compound characterized by its complex structure, which includes a piperidine ring and a quinoxaline moiety. This compound typically exhibits properties associated with both amines and esters, given its functional groups. It is likely to be a solid at room temperature, with potential solubility in organic solvents, depending on the specific substituents and their interactions. The presence of the chloro group may impart specific reactivity, making it useful in various synthetic applications or as a pharmacological agent. Additionally, the dimethyl group contributes to steric hindrance, which can influence the compound's biological activity and interaction with target molecules. Overall, this compound's unique structure suggests potential applications in medicinal chemistry, particularly in the development of novel therapeutic agents. However, detailed studies would be necessary to fully elucidate its properties and potential uses.

Formula: C₁₈H₂₃ClN₄O₂

InChI: InChI=1S/C18H23ClN4O2/c1-18(2,3)25-17(24)23-10-6-7-12(11-23)20-16-15(19)21-13-8-4-5-9-14(13)22-16/h4-5,8-9,12H,6-7,10-11H2,1-3H3,(H,20,22)

InChI key: InChIKey=PVPPGFGNTNGHGO-UHFFFAOYSA-N

SMILES: N(C1=NC2=C(N=C1Cl)C=CC=C2)C3CN(C(OC(C)(C)C)=O)CCC3

Synonyms:

• 1,1-Dimethylethyl 3-[(3-chloro-2-quinoxalinyl)amino]-1-piperidinecarboxylate
• 1-Piperidinecarboxylic acid, 3-[(3-chloro-2-quinoxalinyl)amino]-, 1,1-dimethylethyl ester