CAS 939986-06-8

1,1-Dimethylethyl 3-[[(3-chloro-2-quinoxalinyl)amino]methyl]-1-piperidinecarboxylate

Description:

1,1-Dimethylethyl 3-[[(3-chloro-2-quinoxalinyl)amino]methyl]-1-piperidinecarboxylate, identified by its CAS number 939986-06-8, is a chemical compound that features a complex structure incorporating a piperidine ring and a quinoxaline moiety. This compound is characterized by its potential biological activity, often explored in medicinal chemistry for its pharmacological properties. The presence of the chloro group on the quinoxaline ring may influence its reactivity and interaction with biological targets. Additionally, the dimethyl group contributes to the steric bulk, which can affect the compound's binding affinity and selectivity. The carboxylate functional group is significant for solubility and reactivity, making it a candidate for further chemical modifications. Overall, this compound's unique structural features suggest potential applications in drug development, particularly in areas targeting specific receptors or enzymes. However, detailed studies on its efficacy, safety, and mechanism of action would be necessary to fully understand its potential in therapeutic contexts.

Formula: C₁₉H₂₅ClN₄O₂

InChI: InChI=1S/C19H25ClN4O2/c1-19(2,3)26-18(25)24-10-6-7-13(12-24)11-21-17-16(20)22-14-8-4-5-9-15(14)23-17/h4-5,8-9,13H,6-7,10-12H2,1-3H3,(H,21,23)

InChI key: InChIKey=YRVZVURHHYSPTM-UHFFFAOYSA-N

SMILES: N(CC1CN(C(OC(C)(C)C)=O)CCC1)C2=NC3=C(N=C2Cl)C=CC=C3

Synonyms:

• 1,1-Dimethylethyl 3-[[(3-chloro-2-quinoxalinyl)amino]methyl]-1-piperidinecarboxylate
• 1-Piperidinecarboxylic acid, 3-[[(3-chloro-2-quinoxalinyl)amino]methyl]-, 1,1-dimethylethyl ester