
CAS 939986-07-9
:1-(6-Chloro-3-pyridazinyl)-3-piperidinemethanol
Description:
1-(6-Chloro-3-pyridazinyl)-3-piperidinemethanol is a chemical compound characterized by its unique structure, which includes a pyridazine ring and a piperidine moiety. The presence of the chloro group on the pyridazine ring contributes to its reactivity and potential biological activity. This compound typically exhibits properties such as solubility in polar solvents, which is common for amine-containing compounds due to the presence of hydroxyl groups that can engage in hydrogen bonding. Its molecular structure suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals, as compounds with similar frameworks often exhibit interesting pharmacological properties. The compound's specific interactions with biological targets would depend on its conformation and the presence of functional groups that can participate in binding interactions. Overall, 1-(6-Chloro-3-pyridazinyl)-3-piperidinemethanol represents a class of compounds that may be of interest for further research in drug discovery and development.
Formula:C10H14ClN3O
InChI:InChI=1S/C10H14ClN3O/c11-9-3-4-10(13-12-9)14-5-1-2-8(6-14)7-15/h3-4,8,15H,1-2,5-7H2
InChI key:InChIKey=ZJMRKZQVJAUYJG-UHFFFAOYSA-N
SMILES:C(O)C1CN(CCC1)C2=CC=C(Cl)N=N2
Synonyms:- 3-Piperidinemethanol, 1-(6-chloro-3-pyridazinyl)-
- [1-(6-Chloropyridazin-3-yl)piperidin-3-yl]methanol
- 1-(6-Chloro-3-pyridazinyl)-3-piperidinemethanol
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.