CAS 939986-08-0

1,1-Dimethylethyl N-[1-(6-chloro-3-pyridazinyl)-3-piperidinyl]carbamate

Description:

1,1-Dimethylethyl N-[1-(6-chloro-3-pyridazinyl)-3-piperidinyl]carbamate, with the CAS number 939986-08-0, is a chemical compound characterized by its complex structure, which includes a carbamate functional group and a piperidine ring. This compound is typically recognized for its potential applications in pharmaceuticals, particularly in the development of therapeutic agents. The presence of the chloro-substituted pyridazine moiety suggests it may exhibit specific biological activities, possibly related to its interaction with various biological targets. The dimethyl group contributes to the steric hindrance, which can influence the compound's reactivity and binding affinity. Additionally, the compound's solubility, stability, and overall behavior in biological systems would be influenced by its molecular structure. As with many compounds in medicinal chemistry, understanding its pharmacokinetics and pharmacodynamics is crucial for assessing its efficacy and safety in potential applications. Further studies would be necessary to elucidate its specific properties and mechanisms of action.

Formula: C₁₄H₂₁ClN₄O₂

InChI: InChI=1S/C14H21ClN4O2/c1-14(2,3)21-13(20)16-10-5-4-8-19(9-10)12-7-6-11(15)17-18-12/h6-7,10H,4-5,8-9H2,1-3H3,(H,16,20)

InChI key: InChIKey=STBYZIXCPVUJTQ-UHFFFAOYSA-N

SMILES: N(C(OC(C)(C)C)=O)C1CN(C2=CC=C(Cl)N=N2)CCC1

Synonyms:

• Carbamic acid, N-[1-(6-chloro-3-pyridazinyl)-3-piperidinyl]-, 1,1-dimethylethyl ester
• 1,1-Dimethylethyl N-[1-(6-chloro-3-pyridazinyl)-3-piperidinyl]carbamate