
CAS 939986-16-0
:1,1-Dimethylethyl 3-[(3-nitro-2-pyridinyl)amino]-1-piperidinecarboxylate
Description:
1,1-Dimethylethyl 3-[(3-nitro-2-pyridinyl)amino]-1-piperidinecarboxylate, with the CAS number 939986-16-0, is a chemical compound characterized by its complex structure, which includes a piperidine ring and a nitro-substituted pyridine moiety. This compound features a tert-butyl group, contributing to its steric bulk and potentially influencing its solubility and reactivity. The presence of the nitro group suggests that it may exhibit specific electronic properties, which can affect its interaction with biological targets. The carboxylate functional group indicates that it may participate in various chemical reactions, including esterification or amidation. Additionally, the compound's structure suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals, due to the presence of both basic and acidic functional groups that can engage in hydrogen bonding and other interactions. Overall, this compound's unique combination of functional groups and structural features may confer interesting biological activities and reactivity patterns, warranting further investigation in chemical and pharmaceutical research.
Formula:C15H22N4O4
InChI:InChI=1S/C15H22N4O4/c1-15(2,3)23-14(20)18-9-5-6-11(10-18)17-13-12(19(21)22)7-4-8-16-13/h4,7-8,11H,5-6,9-10H2,1-3H3,(H,16,17)
InChI key:InChIKey=VEACKSITCSNUAH-UHFFFAOYSA-N
SMILES:N(C1=C(N(=O)=O)C=CC=N1)C2CN(C(OC(C)(C)C)=O)CCC2
Synonyms:- 1,1-Dimethylethyl 3-[(3-nitro-2-pyridinyl)amino]-1-piperidinecarboxylate
- 1-Piperidinecarboxylic acid, 3-[(3-nitro-2-pyridinyl)amino]-, 1,1-dimethylethyl ester
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.